EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2.HNO3 |
| Net Charge | 0 |
| Average Mass | 263.297 |
| Monoisotopic Mass | 263.12699 |
| SMILES | O=[N+]([O-])O.c1ccc2c(c1)CCCC2C1=NCCN1 |
| InChI | InChI=1S/C13H16N2.HNO3/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13;2-1(3)4/h1-2,4,6,12H,3,5,7-9H2,(H,14,15);(H,2,3,4) |
| InChIKey | SVQFLMKSDLCPAY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. vasoconstrictor agent Drug used to cause constriction of the blood vessels. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrozoline nitrate (CHEBI:145570) has part tetryzoline(1+) (CHEBI:145569) |
| tetrahydrozoline nitrate (CHEBI:145570) has role ophthalmology drug (CHEBI:66981) |
| tetrahydrozoline nitrate (CHEBI:145570) has role sympathomimetic agent (CHEBI:35524) |
| tetrahydrozoline nitrate (CHEBI:145570) has role vasoconstrictor agent (CHEBI:50514) |
| tetrahydrozoline nitrate (CHEBI:145570) is a organic nitrate salt (CHEBI:51085) |
| IUPAC Name |
|---|
| 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole nitrate |
| Synonyms | Source |
|---|---|
| 4,5-dihydro-2-(1,2,3,4-tetrahydro-1-naphthalenyl)-1H-imidazole mononitrate | ChEBI |
| tetryzoline nitrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Narbel | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00756 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:118201-38-0 | ChemIDplus |