EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2.HCl |
| Net Charge | 0 |
| Average Mass | 236.746 |
| Monoisotopic Mass | 236.10803 |
| SMILES | [H]Cl.c1ccc2c(c1)CCCC2C1=NCCN1 |
| InChI | InChI=1S/C13H16N2.ClH/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13;/h1-2,4,6,12H,3,5,7-9H2,(H,14,15);1H |
| InChIKey | BJORNXNYWNIWEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. vasoconstrictor agent Drug used to cause constriction of the blood vessels. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrozoline hydrochloride (CHEBI:9492) has part tetryzoline(1+) (CHEBI:145569) |
| tetrahydrozoline hydrochloride (CHEBI:9492) has role nasal decongestant (CHEBI:77715) |
| tetrahydrozoline hydrochloride (CHEBI:9492) has role sympathomimetic agent (CHEBI:35524) |
| tetrahydrozoline hydrochloride (CHEBI:9492) has role vasoconstrictor agent (CHEBI:50514) |
| tetrahydrozoline hydrochloride (CHEBI:9492) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole hydrochloride |
| Synonyms | Source |
|---|---|
| 2-(1,2,3,4-tetrahydro-1-naphthyl)-2-imidazoline hydrochloride | ChemIDplus |
| 2-(1,2,3,4-tetrahydro-1-naphthyl)-2-imidazoline monohydrochloride | ChemIDplus |
| tetrahydrozoline HCl | DrugBank |
| tetrahydrozoline hydrochloride | ChemIDplus |
| tetrahydrozoline monohydrochloride | ChEBI |
| tetryzoline HCl | ChEBI |
| Brand Names | Source |
|---|---|
| Murine Plus | ChemIDplus |
| Tyzine | KEGG DRUG |
| Vasopos | ChemIDplus |
| Visine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01023 | KEGG DRUG |
| DBSALT001254 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:522-48-5 | ChemIDplus |
| CAS:522-48-5 | KEGG COMPOUND |
| Citations |
|---|