EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11O2 |
| Net Charge | -1 |
| Average Mass | 127.163 |
| Monoisotopic Mass | 127.07645 |
| SMILES | CCC/C(C)=C/C(=O)[O-] |
| InChI | InChI=1S/C7H12O2/c1-3-4-6(2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/p-1/b6-5+ |
| InChIKey | NTWSIWWJPQHFTO-AATRIKPKSA-M |
| Wikipedia |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-3-methylhex-2-enoate (CHEBI:143558) is a monounsaturated fatty acid anion (CHEBI:82680) |
| (2E)-3-methylhex-2-enoate (CHEBI:143558) is a short-chain fatty acid anion (CHEBI:58951) |
| (2E)-3-methylhex-2-enoate (CHEBI:143558) is conjugate base of (2E)-3-methylhex-2-enoic acid (CHEBI:144845) |
| Incoming Relation(s) |
| (2E)-3-methylhex-2-enoic acid (CHEBI:144845) is conjugate acid of (2E)-3-methylhex-2-enoate (CHEBI:143558) |
| IUPAC Name |
|---|
| (2E)-3-methylhex-2-enoate |
| UniProt Name | Source |
|---|---|
| (2E)-3-methylhex-2-enoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21073 | MetaCyc |
| Trans-3-Methyl-2-hexenoic_acid | Wikipedia |
| Citations |
|---|