EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S2 |
| Net Charge | 0 |
| Average Mass | 268.360 |
| Monoisotopic Mass | 268.05515 |
| SMILES | NC(CCSSCCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) |
| InChIKey | ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11592966) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homocystine (CHEBI:17485) has role human metabolite (CHEBI:77746) |
| homocystine (CHEBI:17485) is a homocystines (CHEBI:24612) |
| homocystine (CHEBI:17485) is tautomer of homocystine zwitterion (CHEBI:58163) |
| Incoming Relation(s) |
| L,L-homocystine (CHEBI:141698) is a homocystine (CHEBI:17485) |
| homocystine zwitterion (CHEBI:58163) is tautomer of homocystine (CHEBI:17485) |
| IUPAC Name |
|---|
| 4,4'-disulfanediylbis(2-aminobutanoic acid) |
| Synonyms | Source |
|---|---|
| 4,4'-dithiobis(2-aminobutyric acid) | ChEBI |
| 4,4'-Dithiobis(2-aminobutyric acid) | KEGG COMPOUND |
| Homocystine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01817 | KEGG COMPOUND |
| HMDB0000575 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728581 | Reaxys |
| CAS:462-10-2 | KEGG COMPOUND |
| CAS:462-10-2 | ChemIDplus |
| Citations |
|---|