EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S2 |
| Net Charge | 0 |
| Average Mass | 268.360 |
| Monoisotopic Mass | 268.05515 |
| SMILES | [NH3+][C@@H](CCSSCC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | ZTVZLYBCZNMWCF-WDSKDSINSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L,L-homocystine zwitterion (CHEBI:140613) is a homocystine zwitterion (CHEBI:58163) |
| L,L-homocystine zwitterion (CHEBI:140613) is tautomer of L,L-homocystine (CHEBI:141698) |
| Incoming Relation(s) |
| L,L-homocystine (CHEBI:141698) is tautomer of L,L-homocystine zwitterion (CHEBI:140613) |
| Synonym | Source |
|---|---|
| L-homocystine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L,L-homocystine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HOMOCYSTINE | MetaCyc |