EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141283 - (6E)-nerolidol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+ |
| InChIKey | FQTLCLSUCSAZDY-SDNWHVSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lippia integrifolia (ncbitaxon:925356) | - | DOI (10.1016/j.indcrop.2020.112610) | |
| Camellia sinensis (ncbitaxon:4442) | - | PubMed (32858427) | |
| Pseudodictamnus acetabulosus (ncbitaxon:483793) | - | PubMed (33742746) | Species also known as Ballota acetabulosa. |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. |
| Applications: | herbicide A substance used to destroy plant pests. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. flavouring agent A food additive that is used to added improve the taste or odour of a food. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6E)-nerolidol (CHEBI:141283) is a nerolidol (CHEBI:7524) |
| Incoming Relation(s) |
| (3R,6E)-nerolidol (CHEBI:59959) is a (6E)-nerolidol (CHEBI:141283) |
| (3S,6E)-nerolidol (CHEBI:59958) is a (6E)-nerolidol (CHEBI:141283) |
| IUPAC Name |
|---|
| (6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| Synonyms | Source |
|---|---|
| trans-nerolidol | ChemIDplus |
| (E)-nerolidol | ChEBI |
| (E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (6E)-nerolidol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| E-nerolidol | MetaCyc |
| 2114 | BPDB |
| C00029339 | KNApSAcK |
| FDB021836 | FooDB |
| 4447568 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:40716-66-3 | ChemIDplus |
| CAS:40716-66-3 | NIST Chemistry WebBook |
| Citations |
|---|