EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141283 - (6E)-nerolidol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+ |
| InChIKey | FQTLCLSUCSAZDY-SDNWHVSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | PubMed (32858427) | |
| Lippia integrifolia (ncbitaxon:925356) | - | DOI (10.1016/j.indcrop.2020.112610) | |
| Pseudodictamnus acetabulosus (ncbitaxon:483793) | - | PubMed (33742746) | Species also known as Ballota acetabulosa. |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | herbicide A substance used to destroy plant pests. anti-inflammatory agent Any compound that has anti-inflammatory effects. flavouring agent A food additive that is used to added improve the taste or odour of a food. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6E)-nerolidol (CHEBI:141283) is a nerolidol (CHEBI:7524) |
| Incoming Relation(s) |
| (3R,6E)-nerolidol (CHEBI:59959) is a (6E)-nerolidol (CHEBI:141283) |
| (3S,6E)-nerolidol (CHEBI:59958) is a (6E)-nerolidol (CHEBI:141283) |
| IUPAC Name |
|---|
| (6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| Synonyms | Source |
|---|---|
| (E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | ChemIDplus |
| (E)-nerolidol | ChEBI |
| trans-nerolidol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (6E)-nerolidol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2114 | BPDB |
| 4447568 | ChemSpider |
| C00029339 | KNApSAcK |
| E-nerolidol | MetaCyc |
| FDB021836 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:40716-66-3 | ChemIDplus |
| CAS:40716-66-3 | NIST Chemistry WebBook |
| Citations |
|---|