EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59959 - (3R,6E)-nerolidol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=C[C@](C)(O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+/t15-/m0/s1 |
| InChIKey | FQTLCLSUCSAZDY-GOFCXVBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyrilliotermes angulariceps (ncbitaxon:377900) | - | PubMed (30920958) | |
| Embiratermes neotenicus (ncbitaxon:1367269) | - | PubMed (30920958) | |
| Labiotermes labralis (ncbitaxon:370423) | - | PubMed (30920958) | |
| Silvestritermes heyeri (ncbitaxon:1934602) | - | PubMed (30920958) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. flavouring agent A food additive that is used to added improve the taste or odour of a food. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. insect attractant A chemical that attracts insects. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. flavouring agent A food additive that is used to added improve the taste or odour of a food. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,6E)-nerolidol (CHEBI:59959) has role animal metabolite (CHEBI:75767) |
| (3R,6E)-nerolidol (CHEBI:59959) is a (6E)-nerolidol (CHEBI:141283) |
| (3R,6E)-nerolidol (CHEBI:59959) is enantiomer of (3S,6E)-nerolidol (CHEBI:59958) |
| Incoming Relation(s) |
| (3S,6E)-nerolidol (CHEBI:59958) is enantiomer of (3R,6E)-nerolidol (CHEBI:59959) |
| IUPAC Name |
|---|
| (3R,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| Synonym | Source |
|---|---|
| (3R)-(6E)-nerolidol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (3R,6E)-nerolidol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4307250 | Beilstein |
| CAS:77551-75-8 | ChemIDplus |
| Citations |
|---|