EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59959 - (3R,6E)-nerolidol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=C[C@](C)(O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+/t15-/m0/s1 |
| InChIKey | FQTLCLSUCSAZDY-GOFCXVBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Embiratermes neotenicus (ncbitaxon:1367269) | - | PubMed (30920958) | |
| Silvestritermes heyeri (ncbitaxon:1934602) | - | PubMed (30920958) | |
| Cyrilliotermes angulariceps (ncbitaxon:377900) | - | PubMed (30920958) | |
| Labiotermes labralis (ncbitaxon:370423) | - | PubMed (30920958) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. insect attractant A chemical that attracts insects. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. flavouring agent A food additive that is used to added improve the taste or odour of a food. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. herbicide A substance used to destroy plant pests. flavouring agent A food additive that is used to added improve the taste or odour of a food. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,6E)-nerolidol (CHEBI:59959) has role animal metabolite (CHEBI:75767) |
| (3R,6E)-nerolidol (CHEBI:59959) is a (6E)-nerolidol (CHEBI:141283) |
| (3R,6E)-nerolidol (CHEBI:59959) is enantiomer of (3S,6E)-nerolidol (CHEBI:59958) |
| Incoming Relation(s) |
| (3S,6E)-nerolidol (CHEBI:59958) is enantiomer of (3R,6E)-nerolidol (CHEBI:59959) |
| IUPAC Name |
|---|
| (3R,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| Synonym | Source |
|---|---|
| (3R)-(6E)-nerolidol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (3R,6E)-nerolidol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4307250 | Beilstein |
| CAS:77551-75-8 | ChemIDplus |
| Citations |
|---|