EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59958 - (3S,6E)-nerolidol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+/t15-/m1/s1 |
| InChIKey | FQTLCLSUCSAZDY-ATGUSINASA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. flavouring agent A food additive that is used to added improve the taste or odour of a food. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. herbicide A substance used to destroy plant pests. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,6E)-nerolidol (CHEBI:59958) is a (6E)-nerolidol (CHEBI:141283) |
| (3S,6E)-nerolidol (CHEBI:59958) is enantiomer of (3R,6E)-nerolidol (CHEBI:59959) |
| Incoming Relation(s) |
| (3R,6E)-nerolidol (CHEBI:59959) is enantiomer of (3S,6E)-nerolidol (CHEBI:59958) |
| IUPAC Name |
|---|
| (3S,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| Synonyms | Source |
|---|---|
| (S-(E))-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | ChemIDplus |
| (3S,6E)-Nerolidol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (3S,6E)-nerolidol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103010005 | LIPID MAPS |
| C09704 | KEGG COMPOUND |
| 4444858 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5248349 | Beilstein |
| CAS:1119-38-6 | ChemIDplus |
| Citations |
|---|