EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O4 |
| Net Charge | 0 |
| Average Mass | 226.272 |
| Monoisotopic Mass | 226.12051 |
| SMILES | O=C(O)C[C@H]1CCC(=O)[C@H]1C/C=C\CCO |
| InChI | InChI=1S/C12H18O4/c13-7-3-1-2-4-10-9(8-12(15)16)5-6-11(10)14/h1-2,9-10,13H,3-8H2,(H,15,16)/b2-1-/t9-,10+/m1/s1 |
| InChIKey | RZGFUGXQKMEMOO-SZXTZRQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| fruit (BTO:0000486) | MetaboLights (MTBLS111) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS107) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS109) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS108) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS110) | ||
| fruit (BTO:0000486) | DOI (10.1007/s11306-014-0728-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuberonic acid (CHEBI:133220) has functional parent (+)-7-isojasmonic acid (CHEBI:18435) |
| tuberonic acid (CHEBI:133220) has role jasmonates (CHEBI:24937) |
| tuberonic acid (CHEBI:133220) has role plant metabolite (CHEBI:76924) |
| tuberonic acid (CHEBI:133220) is a cyclopentanones (CHEBI:36140) |
| tuberonic acid (CHEBI:133220) is a homoallylic alcohol (CHEBI:134362) |
| tuberonic acid (CHEBI:133220) is a oxo monocarboxylic acid (CHEBI:35871) |
| tuberonic acid (CHEBI:133220) is a primary alcohol (CHEBI:15734) |
| tuberonic acid (CHEBI:133220) is conjugate acid of tuberonate (CHEBI:136182) |
| Incoming Relation(s) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) has functional parent tuberonic acid (CHEBI:133220) |
| methyl tuberonate (CHEBI:133219) has functional parent tuberonic acid (CHEBI:133220) |
| tuberonate (CHEBI:136182) is conjugate base of tuberonic acid (CHEBI:133220) |
| IUPAC Name |
|---|
| {(1R,2S)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetic acid |
| Synonyms | Source |
|---|---|
| (+)-12-hydroxy-7-isojasmonic acid | ChEBI |
| 12-hydroxy-epi-jasmonic acid | ChEBI |
| (1R,2S)-3-oxo-2-(5'-hydroxy-2'Z-pentenyl)-cyclopentaneacetic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 4947920 | ChemSpider |
| C00000221 | KNApSAcK |
| LMFA02020007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11073168 | Reaxys |
| CAS:124649-26-9 | ChemIDplus |