EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O3 |
| Net Charge | 0 |
| Average Mass | 210.273 |
| Monoisotopic Mass | 210.12559 |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+/m1/s1 |
| InChIKey | ZNJFBWYDHIGLCU-QKMQQOOLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-7-isojasmonic acid (CHEBI:18435) has role jasmonates (CHEBI:24937) |
| (+)-7-isojasmonic acid (CHEBI:18435) has role plant metabolite (CHEBI:76924) |
| (+)-7-isojasmonic acid (CHEBI:18435) is a oxo carboxylic acid (CHEBI:25754) |
| (+)-7-isojasmonic acid (CHEBI:18435) is a oxylipin (CHEBI:61121) |
| (+)-7-isojasmonic acid (CHEBI:18435) is conjugate acid of (+)-7-isojasmonate (CHEBI:136179) |
| Incoming Relation(s) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) has functional parent (+)-7-isojasmonic acid (CHEBI:18435) |
| tuberonic acid (CHEBI:133220) has functional parent (+)-7-isojasmonic acid (CHEBI:18435) |
| (+)-7-isojasmonate (CHEBI:136179) is conjugate base of (+)-7-isojasmonic acid (CHEBI:18435) |
| IUPAC Name |
|---|
| {(1R,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetic acid |
| Synonyms | Source |
|---|---|
| 2-[(1R,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid | KEGG COMPOUND |
| (+)-7-iso-jasmonic acid | ChEBI |
| (+)-7-isojasmonic acid | ChEBI |
| (+)-Epijasmonic acid | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00000446 | KNApSAcK |
| C16317 | KEGG COMPOUND |
| CPD-731 | MetaCyc |
| LMFA02020003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4180666 | Reaxys |