EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O4 |
| Net Charge | 0 |
| Average Mass | 240.299 |
| Monoisotopic Mass | 240.13616 |
| SMILES | COC(=O)C[C@H]1CCC(=O)[C@H]1C/C=C\CCO |
| InChI | InChI=1S/C13H20O4/c1-17-13(16)9-10-6-7-12(15)11(10)5-3-2-4-8-14/h2-3,10-11,14H,4-9H2,1H3/b3-2-/t10-,11+/m1/s1 |
| InChIKey | XCZTYYQNVNLGKI-UZAOFVRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| fruit (BTO:0000486) | MetaboLights (MTBLS109) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS111) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS110) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS108) | ||
| fruit (BTO:0000486) | DOI (10.1007/s11306-014-0728-9) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS107) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl tuberonate (CHEBI:133219) has functional parent tuberonic acid (CHEBI:133220) |
| methyl tuberonate (CHEBI:133219) has role plant metabolite (CHEBI:76924) |
| methyl tuberonate (CHEBI:133219) is a cyclopentanones (CHEBI:36140) |
| methyl tuberonate (CHEBI:133219) is a homoallylic alcohol (CHEBI:134362) |
| methyl tuberonate (CHEBI:133219) is a methyl ester (CHEBI:25248) |
| methyl tuberonate (CHEBI:133219) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| methyl {(1R,2S)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8267807 | Reaxys |