EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO5 |
| Net Charge | 0 |
| Average Mass | 339.432 |
| Monoisotopic Mass | 339.20457 |
| SMILES | CC[C@H](C)[C@H](NC(=O)C[C@H]1CCC(=O)[C@H]1C/C=C\CCO)C(=O)O |
| InChI | InChI=1S/C18H29NO5/c1-3-12(2)17(18(23)24)19-16(22)11-13-8-9-15(21)14(13)7-5-4-6-10-20/h4-5,12-14,17,20H,3,6-11H2,1-2H3,(H,19,22)(H,23,24)/b5-4-/t12-,13+,14-,17-/m0/s1 |
| InChIKey | TXHIPUZLOILIIU-RAJZRIHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | PubMed (27500669) | ||
| - | MetaboLights (MTBLS312) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) has functional parent tuberonic acid (CHEBI:133220) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) has role Brassica napus metabolite (CHEBI:140165) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) is a L-isoleucine derivative (CHEBI:84111) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) is a fatty amide (CHEBI:29348) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) is a homoallylic alcohol (CHEBI:134362) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) is a primary alcohol (CHEBI:15734) |
| N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) is conjugate acid of N-[(+)-12-hydroxy-7-isojasmonyl]-L-isoleucinate (CHEBI:136181) |
| Incoming Relation(s) |
| N-[(+)-12-hydroxy-7-isojasmonyl]-L-isoleucinate (CHEBI:136181) is conjugate base of N-[(+)-12-hydroxy-7-isojasmonyl]isoleucine (CHEBI:137044) |
| IUPAC Name |
|---|
| N-({(1R,2S)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetyl)-L-isoleucine |
| Synonyms | Source |
|---|---|
| 12-OH-7-iso-JA-Ile | ChEBI |
| 12-OH-7-iso-JA-L-Ile | ChEBI |
| (2S,3S)-2-(2-{(1R,2S)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetamido)-3-methylpentanoic acid | IUPAC |
| (3R,7S)-12-hydroxyjasmonoyl-isoleucine | MetaCyc |
| (3R,7S)-12-hydroxyjasmonoyl-L-isoleucine | MetaCyc |
| (3R,7S)-12-OH-JA-Ile | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-13420 | MetaCyc |