EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CC[C@H](O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,15,17,19,21H,2-3,8-9,14,16,18H2,1H3,(H,22,23)/p-1/b6-4-,7-5-,12-10-,13-11-,17-15+/t19-/m0/s1 |
| InChIKey | LRWYBGFSVUBWMO-OKIFYYRFSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18(S)-HEPE(1−) (CHEBI:132083) is a 18-HEPE(1−) (CHEBI:90825) |
| 18(S)-HEPE(1−) (CHEBI:132083) is conjugate base of 18(S)-HEPE (CHEBI:132801) |
| 18(S)-HEPE(1−) (CHEBI:132083) is enantiomer of 18(R)-HEPE(1−) (CHEBI:90818) |
| Incoming Relation(s) |
| 18(S)-HEPE (CHEBI:132801) is conjugate acid of 18(S)-HEPE(1−) (CHEBI:132083) |
| 18(R)-HEPE(1−) (CHEBI:90818) is enantiomer of 18(S)-HEPE(1−) (CHEBI:132083) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| Synonym | Source |
|---|---|
| (18S)-hydroxy-(5Z,8Z,11Z,14Z,16E)-icosapentaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (18S)-hydroxy-(5Z,8Z,11Z,14Z,16E)-eicosapentaenoate | UniProt |
| Citations |
|---|