EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O6S |
| Net Charge | 0 |
| Average Mass | 307.328 |
| Monoisotopic Mass | 307.08381 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (4200890) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. skin lightening agent Any cosmetic used to lighten the colour of skin by reducing the concentration of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathione (CHEBI:16856) has role Escherichia coli metabolite (CHEBI:76971) |
| glutathione (CHEBI:16856) has role antioxidant (CHEBI:22586) |
| glutathione (CHEBI:16856) has role cofactor (CHEBI:23357) |
| glutathione (CHEBI:16856) has role geroprotector (CHEBI:176497) |
| glutathione (CHEBI:16856) has role human metabolite (CHEBI:77746) |
| glutathione (CHEBI:16856) has role mouse metabolite (CHEBI:75771) |
| glutathione (CHEBI:16856) has role skin lightening agent (CHEBI:85046) |
| glutathione (CHEBI:16856) is a L-cysteine derivative (CHEBI:83824) |
| glutathione (CHEBI:16856) is a thiol (CHEBI:29256) |
| glutathione (CHEBI:16856) is a tripeptide (CHEBI:47923) |
| glutathione (CHEBI:16856) is conjugate acid of glutathionate(1−) (CHEBI:57925) |
| Incoming Relation(s) |
| N-(4-oxoglutaryl)-L-cysteinylglycine (CHEBI:138934) has functional parent glutathione (CHEBI:16856) |
| S-(2-hydroxyethyl)glutathione (CHEBI:35896) has functional parent glutathione (CHEBI:16856) |
| S-(2,4-dinitrophenyl)glutathione (CHEBI:8927) has functional parent glutathione (CHEBI:16856) |
| S-acylglutathione (CHEBI:18126) has functional parent glutathione (CHEBI:16856) |
| S-sulfanylglutathione (CHEBI:52857) has functional parent glutathione (CHEBI:16856) |
| S-sulfoglutathione (CHEBI:195386) has functional parent glutathione (CHEBI:16856) |
| DON-10-glutathione (CHEBI:149452) has functional parent glutathione (CHEBI:16856) |
| eoxin C4 (CHEBI:63984) has functional parent glutathione (CHEBI:16856) |
| glutathione derivative (CHEBI:24337) has functional parent glutathione (CHEBI:16856) |
| phytochelatin (CHEBI:60836) has functional parent glutathione (CHEBI:16856) |
| glutathionate(1−) (CHEBI:57925) is conjugate base of glutathione (CHEBI:16856) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| Glutathione | KEGG COMPOUND |
| Reduced glutathione | KEGG COMPOUND |
| 5-L-Glutamyl-L-cysteinylglycine | KEGG COMPOUND |
| N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine | KEGG COMPOUND |
| gamma-L-Glutamyl-L-cysteinyl-glycine | KEGG COMPOUND |
| GSH | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00051 | KEGG COMPOUND |
| GSH | PDBeChem |
| Glutathione | Wikipedia |
| D00014 | KEGG DRUG |
| GLUTATHIONE | MetaCyc |
| DB00143 | DrugBank |
| HMDB0000125 | HMDB |
| C00001518 | KNApSAcK |
| FDB001498 | FooDB |
| 1312 | DrugCentral |
| 111188 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729812 | Reaxys |
| CAS:70-18-8 | KEGG COMPOUND |
| CAS:70-18-8 | ChemIDplus |
| Citations |
|---|