EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O6S2 |
| Net Charge | 0 |
| Average Mass | 339.395 |
| Monoisotopic Mass | 339.05588 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S2/c11-5(10(18)19)1-2-7(14)13-6(4-21-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | QBOLVLBSUGJHGB-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-sulfanylglutathione (CHEBI:52857) has functional parent glutathione (CHEBI:16856) |
| S-sulfanylglutathione (CHEBI:52857) is a S-substituted glutathione (CHEBI:17021) |
| S-sulfanylglutathione (CHEBI:52857) is a L-cysteine derivative (CHEBI:83824) |
| S-sulfanylglutathione (CHEBI:52857) is a tripeptide (CHEBI:47923) |
| S-sulfanylglutathione (CHEBI:52857) is conjugate acid of S-sulfanylglutathionate(1−) (CHEBI:58905) |
| Incoming Relation(s) |
| S-sulfanylglutathionate(1−) (CHEBI:58905) is conjugate base of S-sulfanylglutathione (CHEBI:52857) |
| IUPAC Name |
|---|
| L-γ-glutamyl-3-disulfanyl-L-alanylglycine |
| Synonyms | Source |
|---|---|
| L-γ-glutamyl-3-dithio-L-alanylglycine | ChEBI |
| S-Sulfanylglutathione | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17267 | KEGG COMPOUND |
| Citations |
|---|