EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N5O10S |
| Net Charge | 0 |
| Average Mass | 473.420 |
| Monoisotopic Mass | 473.08526 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H19N5O10S/c17-9(16(26)27)2-4-13(22)19-10(15(25)18-6-14(23)24)7-32-12-3-1-8(20(28)29)5-11(12)21(30)31/h1,3,5,9-10H,2,4,6-7,17H2,(H,18,25)(H,19,22)(H,23,24)(H,26,27)/t9-,10-/m0/s1 |
| InChIKey | FXEUKVKGTKDDIQ-UWVGGRQHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2,4-dinitrophenyl)glutathione (CHEBI:8927) has functional parent glutathione (CHEBI:16856) |
| S-(2,4-dinitrophenyl)glutathione (CHEBI:8927) is a glutathione conjugate (CHEBI:24335) |
| S-(2,4-dinitrophenyl)glutathione (CHEBI:8927) is conjugate acid of S-(2,4-dinitrophenyl)glutathione(1−) (CHEBI:133977) |
| Incoming Relation(s) |
| S-(2,4-dinitrophenyl)glutathione(1−) (CHEBI:133977) is conjugate base of S-(2,4-dinitrophenyl)glutathione (CHEBI:8927) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-(2,4-dinitrophenyl)-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| dinitrophenyl-S-glutathione | ChEBI |
| DNP-SG | MetaCyc |
| DNP-S-glutathione | ChEBI |
| S-(2,4-Dinitrophenyl)glutathione | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11175 | KEGG COMPOUND |
| GDN | PDBeChem |
| S-24-DINITROPHENYLGLUTATHIONE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2033318 | Beilstein |
| Reaxys:2199791 | Reaxys |
| CAS:26289-39-4 | ChemIDplus |
| CAS:26289-39-4 | KEGG COMPOUND |
| Citations |
|---|