EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O7S |
| Net Charge | 0 |
| Average Mass | 306.296 |
| Monoisotopic Mass | 306.05217 |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C10H14N2O7S/c13-6(10(18)19)1-2-7(14)12-5(4-20)9(17)11-3-8(15)16/h5,20H,1-4H2,(H,11,17)(H,12,14)(H,15,16)(H,18,19)/t5-/m0/s1 |
| InChIKey | PMIVQUCENWNWHX-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-oxoglutaryl)-L-cysteinylglycine (CHEBI:138934) has functional parent glutathione (CHEBI:16856) |
| N-(4-oxoglutaryl)-L-cysteinylglycine (CHEBI:138934) is a dipeptide (CHEBI:46761) |
| N-(4-oxoglutaryl)-L-cysteinylglycine (CHEBI:138934) is conjugate acid of N-(4-oxoglutaryl)-L-cysteinylglycine(2−) (CHEBI:138256) |
| Incoming Relation(s) |
| N-(4-oxoglutaryl)-L-cysteinylglycine(2−) (CHEBI:138256) is conjugate base of N-(4-oxoglutaryl)-L-cysteinylglycine (CHEBI:138934) |
| IUPAC Name |
|---|
| N-(4-carboxy-4-oxobutanoyl)-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| deaminated glutathione | MetaCyc |
| γ-(4-oxoglutaryl)-L-cysteinylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19971 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31104039 | Reaxys |
| Citations |
|---|