EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | O=C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| InChIKey | XQXPVVBIMDBYFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (7126379) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth |
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) has functional parent acetic acid (CHEBI:15366) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) has role fungal metabolite (CHEBI:76946) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) has role human metabolite (CHEBI:77746) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) has role mouse metabolite (CHEBI:75771) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) has role plant metabolite (CHEBI:76924) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) is a monocarboxylic acid (CHEBI:25384) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) is a phenols (CHEBI:33853) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) is conjugate acid of 4-hydroxyphenylacetate (CHEBI:48999) |
| Incoming Relation(s) |
| 11β,13-dihydrolactucopicrin (CHEBI:90283) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| 11β,13-dihydrolactucopicrin 15-oxalate (CHEBI:90281) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| 4-hydroxyphenylacetyl-CoA (CHEBI:28773) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| ixerochinolide (CHEBI:66100) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| lactucopicrin (CHEBI:90275) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| lactucopicrin 15-oxalate (CHEBI:90280) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| methyl 2-(4-hydroxyphenyl)acetate (CHEBI:68078) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| 4-hydroxyphenylacetate (CHEBI:48999) is conjugate base of 4-hydroxyphenylacetic acid (CHEBI:18101) |
| IUPAC Name |
|---|
| (4-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 4-carboxymethylphenol | ChemIDplus |
| 4-hydroxybenzeneacetic acid | ChemIDplus |
| 4-Hydroxyphenylacetate | KEGG COMPOUND |
| 4-Hydroxyphenylacetic acid | KEGG COMPOUND |
| (p-hydroxyphenyl)acetic acid | ChemIDplus |
| p-hydroxyphenylacetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4HP | PDBeChem |
| 4-HYDROXYPHENYLACETATE | MetaCyc |
| 4-hydroxyphenylacetic_acid | Wikipedia |
| C00642 | KEGG COMPOUND |
| C00642 | KEGG COMPOUND |
| c0271 | UM-BBD |
| HMDB0000020 | HMDB |
| Citations |
|---|