EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | [H][C@]12C(COC(=O)C(=O)O)=CC(=O)C1=C(C)C[C@H](OC(=O)Cc1ccc(O)cc1)[C@@]1([H])C(=C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C25H22O10/c1-11-7-17(34-18(28)8-13-3-5-15(26)6-4-13)20-12(2)24(31)35-22(20)21-14(9-16(27)19(11)21)10-33-25(32)23(29)30/h3-6,9,17,20-22,26H,2,7-8,10H2,1H3,(H,29,30)/t17-,20+,21-,22-/m0/s1 |
| InChIKey | AUULYUITRYGGJX-XGARDCMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cichorium intybus (ncbitaxon:13427) | - | MetaboLights (MTBLS270) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lactucopicrin 15-oxalate (CHEBI:90280) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| lactucopicrin 15-oxalate (CHEBI:90280) has functional parent lactucin (CHEBI:6358) |
| lactucopicrin 15-oxalate (CHEBI:90280) has functional parent oxalic acid (CHEBI:16995) |
| lactucopicrin 15-oxalate (CHEBI:90280) has role plant metabolite (CHEBI:76924) |
| lactucopicrin 15-oxalate (CHEBI:90280) is a azulenofuran (CHEBI:39433) |
| lactucopicrin 15-oxalate (CHEBI:90280) is a cyclic terpene ketone (CHEBI:36130) |
| lactucopicrin 15-oxalate (CHEBI:90280) is a enone (CHEBI:51689) |
| lactucopicrin 15-oxalate (CHEBI:90280) is a oxo monocarboxylic acid (CHEBI:35871) |
| lactucopicrin 15-oxalate (CHEBI:90280) is a phenols (CHEBI:33853) |
| lactucopicrin 15-oxalate (CHEBI:90280) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| {[(3aR,4S,9aS,9bR)-4-{[(4-hydroxyphenyl)acetyl]oxy}-6-methyl-3-methylidene-2,7-dioxo-2,3,3a,4,5,7,9a,9b-octahydroazuleno[4,5-b]furan-9-yl]methoxy}(oxo)acetic acid |
| Synonyms | Source |
|---|---|
| 15-oxalyllactucopicrin | ChEBI |
| Lactucopicrin-15-oxalate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00034018 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:303130-75-8 | KNApSAcK |