EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | COC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O3/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5,10H,6H2,1H3 |
| InChIKey | XGDZEDRBLVIUMX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 2-(4-hydroxyphenyl)acetate (CHEBI:68078) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| methyl 2-(4-hydroxyphenyl)acetate (CHEBI:68078) has role Penicillium metabolite (CHEBI:76964) |
| methyl 2-(4-hydroxyphenyl)acetate (CHEBI:68078) is a methyl ester (CHEBI:25248) |
| methyl 2-(4-hydroxyphenyl)acetate (CHEBI:68078) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl (4-hydroxyphenyl)acetate |
| Synonym | Source |
|---|---|
| 4-hydroxybenzeneacetic acid methyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2087538 | Reaxys |
| CAS:14199-15-6 | ChemIDplus |
| Citations |
|---|