EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])[C@H](OC(=O)Cc1ccc(O)cc1)CC(=C)[C@]1([H])C[C@H](O)C(=C)[C@]21[H] |
| InChI | InChI=1S/C23H24O6/c1-11-8-18(28-19(26)9-14-4-6-15(24)7-5-14)21-13(3)23(27)29-22(21)20-12(2)17(25)10-16(11)20/h4-7,16-18,20-22,24-25H,1-3,8-10H2/t16-,17-,18+,20-,21+,22+/m0/s1 |
| InChIKey | BBTINGNPUAXELD-QPOFKBRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ixeris chinensis (ncbitaxon:318058) | whole plant (BTO:0001461) | PubMed (15635221) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ixerochinolide (CHEBI:66100) has functional parent 4-hydroxyphenylacetic acid (CHEBI:18101) |
| ixerochinolide (CHEBI:66100) has role antineoplastic agent (CHEBI:35610) |
| ixerochinolide (CHEBI:66100) has role metabolite (CHEBI:25212) |
| ixerochinolide (CHEBI:66100) is a carboxylic ester (CHEBI:33308) |
| ixerochinolide (CHEBI:66100) is a phenols (CHEBI:33853) |
| ixerochinolide (CHEBI:66100) is a secondary alcohol (CHEBI:35681) |
| ixerochinolide (CHEBI:66100) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3aR,4R,6aR,8S,9aR,9bR)-8-hydroxy-3,6,9-trimethylidene-2-oxododecahydroazuleno[4,5-b]furan-4-yl (4-hydroxyphenyl)acetate |
| Synonym | Source |
|---|---|
| 8-O-p-hydroxyphenylacetylintegrifolin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10126830 | Reaxys |
| Citations |
|---|