EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48999 - 4-hydroxyphenylacetate
| Formula | C8H7O3 |
| Net Charge | -1 |
| Average Mass | 151.141 |
| Monoisotopic Mass | 151.04007 |
| SMILES | O=C([O-])Cc1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1 |
| InChIKey | XQXPVVBIMDBYFF-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenylacetate (CHEBI:48999) has functional parent acetate (CHEBI:30089) |
| 4-hydroxyphenylacetate (CHEBI:48999) has role fungal metabolite (CHEBI:76946) |
| 4-hydroxyphenylacetate (CHEBI:48999) has role human metabolite (CHEBI:77746) |
| 4-hydroxyphenylacetate (CHEBI:48999) has role plant metabolite (CHEBI:76924) |
| 4-hydroxyphenylacetate (CHEBI:48999) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-hydroxyphenylacetate (CHEBI:48999) is conjugate base of 4-hydroxyphenylacetic acid (CHEBI:18101) |
| Incoming Relation(s) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) is conjugate acid of 4-hydroxyphenylacetate (CHEBI:48999) |
| IUPAC Name |
|---|
| (4-hydroxyphenyl)acetate |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxyphenyl)ethanoate | ChEBI |
| 4-hydroxybenzeneacetate | ChEBI |
| (p-hydroxyphenyl)acetate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-hydroxyphenylacetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4-HYDROXYPHENYLACETATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3905591 | Reaxys |