EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO2 |
| Net Charge | 0 |
| Average Mass | 153.181 |
| Monoisotopic Mass | 153.07898 |
| SMILES | NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2 |
| InChIKey | VYFYYTLLBUKUHU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dopamine (CHEBI:18243) has role Escherichia coli metabolite (CHEBI:76971) |
| dopamine (CHEBI:18243) has role cardiotonic drug (CHEBI:38147) |
| dopamine (CHEBI:18243) has role dopaminergic agent (CHEBI:48560) |
| dopamine (CHEBI:18243) has role human metabolite (CHEBI:77746) |
| dopamine (CHEBI:18243) has role mouse metabolite (CHEBI:75771) |
| dopamine (CHEBI:18243) has role sympathomimetic agent (CHEBI:35524) |
| dopamine (CHEBI:18243) has role β-adrenergic agonist (CHEBI:35522) |
| dopamine (CHEBI:18243) is a catecholamine (CHEBI:33567) |
| dopamine (CHEBI:18243) is conjugate base of dopaminium(1+) (CHEBI:59905) |
| Incoming Relation(s) |
| (2E)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)acrylamide (CHEBI:139448) has functional parent dopamine (CHEBI:18243) |
| N-[2-(3,4-dihydroxyphenyl)ethyl]-L-glutamine residue (CHEBI:167175) has functional parent dopamine (CHEBI:18243) |
| N-acetyldopamine (CHEBI:125678) has functional parent dopamine (CHEBI:18243) |
| N-oleoyldopamine (CHEBI:31883) has functional parent dopamine (CHEBI:18243) |
| N-palmitoyl dopamine (CHEBI:134058) has functional parent dopamine (CHEBI:18243) |
| 15-HETE-DA (CHEBI:188286) has functional parent dopamine (CHEBI:18243) |
| 3-amino-N-[2-(3,4-dihydroxyphenyl)ethyl]propanamide (CHEBI:125666) has functional parent dopamine (CHEBI:18243) |
| 3-methoxytyramine (CHEBI:1582) has functional parent dopamine (CHEBI:18243) |
| 4-methoxytyramine (CHEBI:89641) has functional parent dopamine (CHEBI:18243) |
| Arachidonoyl dopamine (CHEBI:31231) has functional parent dopamine (CHEBI:18243) |
| Dihomo-gamma-linolenoyl dopamine (CHEBI:187455) has functional parent dopamine (CHEBI:18243) |
| dopamine 3-O-sulfate (CHEBI:37946) has functional parent dopamine (CHEBI:18243) |
| dopamine 4-O-sulfate (CHEBI:34729) has functional parent dopamine (CHEBI:18243) |
| N-[2-(3,4-dihydroxyphenyl)ethyl]-9-octadecenamide (CHEBI:109532) has functional parent dopamine (CHEBI:18243) |
| N-linoleoyl dopamine (CHEBI:183583) has functional parent dopamine (CHEBI:18243) |
| N-stearoyl dopamine (CHEBI:186909) has functional parent dopamine (CHEBI:18243) |
| oxidopamine (CHEBI:78741) has functional parent dopamine (CHEBI:18243) |
| dopaminium(1+) (CHEBI:59905) is conjugate acid of dopamine (CHEBI:18243) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)benzene-1,2-diol |
| INNs | Source |
|---|---|
| dopamina | ChemIDplus |
| dopamine | ChEBI |
| dopaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)ethylamine | ChEBI |
| 2-(3,4-Dihydroxyphenyl)ethylamine | KEGG COMPOUND |
| 3,4-Dihydroxyphenethylamine | KEGG COMPOUND |
| 3-Hydroxytyramine | ChemIDplus |
| 4-(2-aminoethyl)-1,2-benzenediol | ChEBI |
| 4-(2-Aminoethyl)-1,2-benzenediol | KEGG COMPOUND |
| Citations |
|---|