EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O |
| Net Charge | 0 |
| Average Mass | 144.173 |
| Monoisotopic Mass | 144.05751 |
| SMILES | Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| InChIKey | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | electron donor A molecular entity that can transfer an electron to another molecular entity. |
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthol (CHEBI:10319) has role genotoxin (CHEBI:50902) |
| 1-naphthol (CHEBI:10319) has role human xenobiotic metabolite (CHEBI:76967) |
| 1-naphthol (CHEBI:10319) is a naphthol (CHEBI:35682) |
| Incoming Relation(s) |
| 1-naphthyl N-acetyl-β-D-glucosaminide (CHEBI:90331) has functional parent 1-naphthol (CHEBI:10319) |
| 1-naphthyl tetradecanoate (CHEBI:132330) has functional parent 1-naphthol (CHEBI:10319) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has functional parent 1-naphthol (CHEBI:10319) |
| 1-naphthyloxyacetic acid (CHEBI:44588) has functional parent 1-naphthol (CHEBI:10319) |
| carbaryl (CHEBI:3390) has functional parent 1-naphthol (CHEBI:10319) |
| propranolol (CHEBI:8499) has functional parent 1-naphthol (CHEBI:10319) |
| IUPAC Name |
|---|
| naphthalen-1-ol |
| Synonyms | Source |
|---|---|
| alpha-Naphthol | KEGG COMPOUND |
| 1-Naphthol | KEGG COMPOUND |
| α-hydroxynaphthalene | NIST Chemistry WebBook |
| 1-naphthalenol | NIST Chemistry WebBook |
| α-naphthol | NIST Chemistry WebBook |
| alpha-Naphthol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 1-naphthol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11714 | KEGG COMPOUND |
| NAPHTHOL | MetaCyc |
| HMDB0012138 | HMDB |
| 1-Naphthol | Wikipedia |
| 1NP | PDBeChem |
| Citations |
|---|