EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO2 |
| Net Charge | 0 |
| Average Mass | 201.225 |
| Monoisotopic Mass | 201.07898 |
| SMILES | CNC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
| InChIKey | CVXBEEMKQHEXEN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. carbamate insecticide Derivatives of carbamic acid with insecticidal properties of general formula ROC(=O)NR1R2, where ROH is an alcohol, oxime, or phenol and R1 is hydrogen or methyl. Like organophosphate insecticides, they are cholinesterase inhibitors, but carbamate insecticides differ in action from the organophosphates in that the inhibitory effect on cholinesterase is generally brief. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. carbamate insecticide Derivatives of carbamic acid with insecticidal properties of general formula ROC(=O)NR1R2, where ROH is an alcohol, oxime, or phenol and R1 is hydrogen or methyl. Like organophosphate insecticides, they are cholinesterase inhibitors, but carbamate insecticides differ in action from the organophosphates in that the inhibitory effect on cholinesterase is generally brief. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbaryl (CHEBI:3390) has functional parent 1-naphthol (CHEBI:10319) |
| carbaryl (CHEBI:3390) has functional parent methylcarbamic acid (CHEBI:45379) |
| carbaryl (CHEBI:3390) has role acaricide (CHEBI:22153) |
| carbaryl (CHEBI:3390) has role agrochemical (CHEBI:33286) |
| carbaryl (CHEBI:3390) has role carbamate insecticide (CHEBI:38461) |
| carbaryl (CHEBI:3390) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| carbaryl (CHEBI:3390) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| carbaryl (CHEBI:3390) has role plant growth retardant (CHEBI:35219) |
| carbaryl (CHEBI:3390) is a carbamate ester (CHEBI:23003) |
| carbaryl (CHEBI:3390) is a naphthalenes (CHEBI:25477) |
| Incoming Relation(s) |
| nitrosocarbaryl (CHEBI:189529) has functional parent carbaryl (CHEBI:3390) |
| IUPAC Name |
|---|
| naphthalen-1-yl methylcarbamate |
| Synonyms | Source |
|---|---|
| 1-Naphthalenol, methylcarbamate | ChemIDplus |
| 1-Naphthalenyl methylcarbamate | ChemIDplus |
| 1-naphthol N-methylcarbamate | ChEBI |
| 1-Naphthyl N-methylcarbamate | ChEBI |
| alpha-Naphthyl N-methylcarbamate | ChEBI |
| Carbaril | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| carbaryl | UniProt |
| Citations |
|---|