EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O6 |
| Net Charge | 0 |
| Average Mass | 306.314 |
| Monoisotopic Mass | 306.11034 |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O6/c17-8-12-13(18)14(19)15(20)16(22-12)21-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-20H,8H2/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | CVAOQMBKGUKOIZ-IBEHDNSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS312) | ||
| - | PubMed (27500669) | ||
| Scenedesmus obliquus (ncbitaxon:3088) | - | PubMed (9000339) |
| Roles Classification |
|---|
| Biological Roles: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has functional parent 1-naphthol (CHEBI:10319) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has role Brassica napus metabolite (CHEBI:140165) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has role algal metabolite (CHEBI:84735) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) is a naphthalenes (CHEBI:25477) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| naphthalen-1-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 1-naphthol glucoside | ChEBI |
| 1-Naphthyl beta-D-glucopyranoside | ChemIDplus |
| 1-Naphthylglucoside | ChemIDplus |
| naphthalen-1-yl β-D-glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:34364 | Reaxys |
| CAS:19939-82-3 | ChemIDplus |
| Citations |
|---|