EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O6 |
| Net Charge | 0 |
| Average Mass | 306.314 |
| Monoisotopic Mass | 306.11034 |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O6/c17-8-12-13(18)14(19)15(20)16(22-12)21-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-20H,8H2/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | CVAOQMBKGUKOIZ-IBEHDNSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS312) | ||
| - | PubMed (27500669) | ||
| Scenedesmus obliquus (ncbitaxon:3088) | - | PubMed (9000339) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has functional parent 1-naphthol (CHEBI:10319) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has role Brassica napus metabolite (CHEBI:140165) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) has role algal metabolite (CHEBI:84735) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) is a naphthalenes (CHEBI:25477) |
| 1-naphthyl β-D-glucoside (CHEBI:136775) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| naphthalen-1-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 1-naphthol glucoside | ChEBI |
| 1-Naphthyl beta-D-glucopyranoside | ChemIDplus |
| 1-Naphthylglucoside | ChemIDplus |
| naphthalen-1-yl β-D-glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:34364 | Reaxys |
| CAS:19939-82-3 | ChemIDplus |
| Citations |
|---|