EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:100241 - ciprofloxacin
| Formula | C17H18FN3O3 |
| Net Charge | 0 |
| Average Mass | 331.347 |
| Monoisotopic Mass | 331.13322 |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O3/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24/h7-10,19H,1-6H2,(H,23,24) |
| InChIKey | MYSWGUAQZAJSOK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciprofloxacin (CHEBI:100241) has role antibacterial drug (CHEBI:36047) |
| ciprofloxacin (CHEBI:100241) has role antiinfective agent (CHEBI:35441) |
| ciprofloxacin (CHEBI:100241) has role antimicrobial agent (CHEBI:33281) |
| ciprofloxacin (CHEBI:100241) has role DNA synthesis inhibitor (CHEBI:59517) |
| ciprofloxacin (CHEBI:100241) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| ciprofloxacin (CHEBI:100241) has role environmental contaminant (CHEBI:78298) |
| ciprofloxacin (CHEBI:100241) has role topoisomerase IV inhibitor (CHEBI:53559) |
| ciprofloxacin (CHEBI:100241) has role xenobiotic (CHEBI:35703) |
| ciprofloxacin (CHEBI:100241) is a N-arylpiperazine (CHEBI:46848) |
| ciprofloxacin (CHEBI:100241) is a aminoquinoline (CHEBI:36709) |
| ciprofloxacin (CHEBI:100241) is a cyclopropanes (CHEBI:51454) |
| ciprofloxacin (CHEBI:100241) is a fluoroquinolone antibiotic (CHEBI:87211) |
| ciprofloxacin (CHEBI:100241) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| ciprofloxacin (CHEBI:100241) is a quinolone (CHEBI:23765) |
| ciprofloxacin (CHEBI:100241) is a quinolone antibiotic (CHEBI:86324) |
| ciprofloxacin (CHEBI:100241) is conjugate base of ciprofloxacin(1+) (CHEBI:192486) |
| ciprofloxacin (CHEBI:100241) is tautomer of ciprofloxacin zwitterion (CHEBI:192484) |
| Incoming Relation(s) |
| 3-oxociprofloxacin (CHEBI:192773) has functional parent ciprofloxacin (CHEBI:100241) |
| sulfociprofloxacin (CHEBI:192798) has functional parent ciprofloxacin (CHEBI:100241) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has part ciprofloxacin (CHEBI:100241) |
| ciprofloxacin(1+) (CHEBI:192486) is conjugate acid of ciprofloxacin (CHEBI:100241) |
| ciprofloxacin zwitterion (CHEBI:192484) is tautomer of ciprofloxacin (CHEBI:100241) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| ciprofloxacin | ChemIDplus |
| ciprofloxacine | ChemIDplus |
| ciprofloxacino | ChemIDplus |
| ciprofloxacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,4-dihydro-quinoline-3-carboxylic acid | ChEMBL |
| 1-CYCLOPROPYL-6-FLUORO-4-OXO-7-PIPERAZIN-1-YL-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID | PDBeChem |
| 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid | ChEMBL |
| 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid | ChEMBL |
| 1-Cyclopropyl-6-fluoro-7-(4-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3568352 | Reaxys |
| CAS:85721-33-1 | ChemIDplus |
| CAS:85721-33-1 | KEGG COMPOUND |
| Citations |
|---|