EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:100241 - ciprofloxacin
| Formula | C17H18FN3O3 |
| Net Charge | 0 |
| Average Mass | 331.347 |
| Monoisotopic Mass | 331.13322 |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O3/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24/h7-10,19H,1-6H2,(H,23,24) |
| InChIKey | MYSWGUAQZAJSOK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antibacterial drug A drug used to treat or prevent bacterial infections. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciprofloxacin (CHEBI:100241) has role antibacterial drug (CHEBI:36047) |
| ciprofloxacin (CHEBI:100241) has role antiinfective agent (CHEBI:35441) |
| ciprofloxacin (CHEBI:100241) has role antimicrobial agent (CHEBI:33281) |
| ciprofloxacin (CHEBI:100241) has role DNA synthesis inhibitor (CHEBI:59517) |
| ciprofloxacin (CHEBI:100241) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| ciprofloxacin (CHEBI:100241) has role environmental contaminant (CHEBI:78298) |
| ciprofloxacin (CHEBI:100241) has role topoisomerase IV inhibitor (CHEBI:53559) |
| ciprofloxacin (CHEBI:100241) has role xenobiotic (CHEBI:35703) |
| ciprofloxacin (CHEBI:100241) is a N-arylpiperazine (CHEBI:46848) |
| ciprofloxacin (CHEBI:100241) is a aminoquinoline (CHEBI:36709) |
| ciprofloxacin (CHEBI:100241) is a cyclopropanes (CHEBI:51454) |
| ciprofloxacin (CHEBI:100241) is a fluoroquinolone antibiotic (CHEBI:87211) |
| ciprofloxacin (CHEBI:100241) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| ciprofloxacin (CHEBI:100241) is a quinolone (CHEBI:23765) |
| ciprofloxacin (CHEBI:100241) is a quinolone antibiotic (CHEBI:86324) |
| ciprofloxacin (CHEBI:100241) is conjugate base of ciprofloxacin(1+) (CHEBI:192486) |
| ciprofloxacin (CHEBI:100241) is tautomer of ciprofloxacin zwitterion (CHEBI:192484) |
| Incoming Relation(s) |
| 3-oxociprofloxacin (CHEBI:192773) has functional parent ciprofloxacin (CHEBI:100241) |
| sulfociprofloxacin (CHEBI:192798) has functional parent ciprofloxacin (CHEBI:100241) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has part ciprofloxacin (CHEBI:100241) |
| ciprofloxacin(1+) (CHEBI:192486) is conjugate acid of ciprofloxacin (CHEBI:100241) |
| ciprofloxacin zwitterion (CHEBI:192484) is tautomer of ciprofloxacin (CHEBI:100241) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| ciprofloxacin | ChemIDplus |
| ciprofloxacine | ChemIDplus |
| ciprofloxacino | ChemIDplus |
| ciprofloxacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,4-dihydro-quinoline-3-carboxylic acid | ChEMBL |
| 1-CYCLOPROPYL-6-FLUORO-4-OXO-7-PIPERAZIN-1-YL-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID | PDBeChem |
| 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid | ChEMBL |
| 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid | ChEMBL |
| 1-Cyclopropyl-6-fluoro-7-(4-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3568352 | Reaxys |
| CAS:85721-33-1 | ChemIDplus |
| CAS:85721-33-1 | KEGG COMPOUND |
| Citations |
|---|