EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18FN3O3.HCl |
| Net Charge | 0 |
| Average Mass | 367.808 |
| Monoisotopic Mass | 367.10990 |
| SMILES | Cl.O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O3.ClH/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24;/h7-10,19H,1-6H2,(H,23,24);1H |
| InChIKey | DIOIOSKKIYDRIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has part ciprofloxacin (CHEBI:100241) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has role antibacterial drug (CHEBI:36047) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has role antiinfective agent (CHEBI:35441) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) has role topoisomerase IV inhibitor (CHEBI:53559) |
| ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| ciprofloxacin dihydrochloride (CHEBI:59938) has part ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) |
| ciprofloxacin hydrochloride hydrate (CHEBI:59936) has part ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid hydrochloride |
| Synonyms | Source |
|---|---|
| 1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid HCl | ChemIDplus |
| 1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid hydrochloride | ChEBI |
| 1-Cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,4-dihydro-quinoline-3-carboxylic acid; hydrochloride | ChEMBL |
| 4-(3-Carboxy-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-quinolin-7-yl)-piperazin-1-ium; chloride | ChEMBL |
| ciprofloxacin HCl | ChEBI |
| CIPROFLOXACIN HYDROCHLORIDE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB00537 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4627629 | Beilstein |
| CAS:86483-48-9 | ChemIDplus |