EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18FN3O6S |
| Net Charge | 0 |
| Average Mass | 411.411 |
| Monoisotopic Mass | 411.09003 |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCN(S(=O)(=O)O)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O6S/c18-13-7-11-14(21(10-1-2-10)9-12(16(11)22)17(23)24)8-15(13)19-3-5-20(6-4-19)28(25,26)27/h7-10H,1-6H2,(H,23,24)(H,25,26,27) |
| InChIKey | SDLYZOYQWKDWJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| bile (BTO:0000121) | PubMed (3790196) | ||
| Urine (NCIT:C13283) | PubMed (34624141) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfociprofloxacin (CHEBI:192798) has functional parent ciprofloxacin (CHEBI:100241) |
| sulfociprofloxacin (CHEBI:192798) has role drug metabolite (CHEBI:49103) |
| sulfociprofloxacin (CHEBI:192798) has role human urinary metabolite (CHEBI:84087) |
| sulfociprofloxacin (CHEBI:192798) is a N-arylpiperazine (CHEBI:46848) |
| sulfociprofloxacin (CHEBI:192798) is a cyclopropanes (CHEBI:51454) |
| sulfociprofloxacin (CHEBI:192798) is a fluoroquinolone antibiotic (CHEBI:87211) |
| sulfociprofloxacin (CHEBI:192798) is a organosulfonic acid (CHEBI:33551) |
| sulfociprofloxacin (CHEBI:192798) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| sulfociprofloxacin (CHEBI:192798) is a quinolone (CHEBI:23765) |
| sulfociprofloxacin (CHEBI:192798) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-4-oxo-7-(4-sulfopiperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| ciprofloxacin piperazinyl-N4-sulfate | ChEBI |
| Bay-s 9435 | ChemIDplus |
| BAY-s-9435 | HMDB |
| Bay s 9435 | ChEBI |
| 1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(4-sulfopiperazino)-3-quinolinecarboxylic acid | ChEBI |
| sulfo-ciprofloxacin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0242136 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:105093-21-8 | ChemIDplus |
| Citations |
|---|