EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192773 - 3-oxociprofloxacin
| Formula | C17H16FN3O4 |
| Net Charge | 0 |
| Average Mass | 345.330 |
| Monoisotopic Mass | 345.11248 |
| SMILES | O=C1CN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CCN1 |
| InChI | InChI=1S/C17H16FN3O4/c18-12-5-10-13(6-14(12)20-4-3-19-15(22)8-20)21(9-1-2-9)7-11(16(10)23)17(24)25/h5-7,9H,1-4,8H2,(H,19,22)(H,24,25) |
| InChIKey | MYYZZOHRULFPOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxociprofloxacin (CHEBI:192773) has functional parent ciprofloxacin (CHEBI:100241) |
| 3-oxociprofloxacin (CHEBI:192773) has role drug metabolite (CHEBI:49103) |
| 3-oxociprofloxacin (CHEBI:192773) is a N-arylpiperazine (CHEBI:46848) |
| 3-oxociprofloxacin (CHEBI:192773) is a cyclopropanes (CHEBI:51454) |
| 3-oxociprofloxacin (CHEBI:192773) is a piperazinone (CHEBI:46846) |
| 3-oxociprofloxacin (CHEBI:192773) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| 3-oxociprofloxacin (CHEBI:192773) is a quinolone (CHEBI:23765) |
| Registry Numbers | Sources |
|---|---|
| CAS:103237-52-1 | ChemIDplus |
| Citations |
|---|