EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5353 - ginkgetin
| Formula | C32H22O10 |
| Net Charge | 0 |
| Average Mass | 566.518 |
| Monoisotopic Mass | 566.12130 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(-c4c(O)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3)oc2c1 |
| InChI | InChI=1S/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3 |
| InChIKey | AIFCFBUSLAEIBR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus harringtonia (ncbitaxon:58029) | - | DOI (10.1016/0031-9422(73)80020-2) | |
| Cephalotaxus harringtonia var. drupacea (ncbitaxon:224739) | |||
| leaf (BTO:0000713) | PubMed (1329635) | ||
| twig (BTO:0001411) | PubMed (1329635) | ||
| Dacrydium (ncbitaxon:56889) | |||
| leaf (BTO:0000713) | PubMed (9134745) | ||
| branch (BTO:0000148) | PubMed (9134745) | Previous component: branchlet; | |
| Dioon (ncbitaxon:58032) | - | DOI (10.1016/0031-9422(73)80020-2) | |
| Ginkgo biloba (ncbitaxon:3311) | leaf (BTO:0000713) | PubMed (16327145) | |
| Selanginella moellendorfii (ncbitaxon:88036) | - | PubMed (9134745) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginkgetin (CHEBI:5353) has functional parent amentoflavone (CHEBI:2631) |
| ginkgetin (CHEBI:5353) has role anti-HSV-1 agent (CHEBI:64953) |
| ginkgetin (CHEBI:5353) has role antineoplastic agent (CHEBI:35610) |
| ginkgetin (CHEBI:5353) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| ginkgetin (CHEBI:5353) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| ginkgetin (CHEBI:5353) has role metabolite (CHEBI:25212) |
| ginkgetin (CHEBI:5353) is a biflavonoid (CHEBI:50128) |
| ginkgetin (CHEBI:5353) is a hydroxyflavone (CHEBI:24698) |
| ginkgetin (CHEBI:5353) is a methoxyflavone (CHEBI:25241) |
| ginkgetin (CHEBI:5353) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4''',5,5'',7''-tetrahydroxy-4',7-dimethoxy-(3'→8'')-biflavone | ChEBI |
| 5,7-dihydroxy-8-(5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenyl)-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| amentoflavone 7,4'-dimethyl ether | ChEBI |
| Amentoflavone 7,4'-dimethyl ether | KEGG COMPOUND |
| Ginkgetin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001044 | KNApSAcK |
| C10048 | KEGG COMPOUND |
| LMPK12040003 | LIPID MAPS |
| LSM-42758 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:381052 | Reaxys |
| CAS:481-46-9 | ChemIDplus |
| CAS:481-46-9 | KEGG COMPOUND |
| Citations |
|---|