EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1a_1-5][ha122h-2b_2-5]/1-2/a1-b2 |
| InChI | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). osmolyte A solute used by a cell under water stress to maintain cell volume. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sucrose (CHEBI:17992) has role Escherichia coli metabolite (CHEBI:76971) |
| sucrose (CHEBI:17992) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| sucrose (CHEBI:17992) has role algal metabolite (CHEBI:84735) |
| sucrose (CHEBI:17992) has role human metabolite (CHEBI:77746) |
| sucrose (CHEBI:17992) has role mouse metabolite (CHEBI:75771) |
| sucrose (CHEBI:17992) has role osmolyte (CHEBI:25728) |
| sucrose (CHEBI:17992) has role sweetening agent (CHEBI:50505) |
| sucrose (CHEBI:17992) is a glycosyl glycoside (CHEBI:24407) |
| Incoming Relation(s) |
| 1,6-kestotetraose (CHEBI:64835) has functional parent sucrose (CHEBI:17992) |
| 6-kestotriose (CHEBI:64833) has functional parent sucrose (CHEBI:17992) |
| 6,6-kestotetraose (CHEBI:64836) has functional parent sucrose (CHEBI:17992) |
| agrocinopine A (CHEBI:82804) has functional parent sucrose (CHEBI:17992) |
| agrocinopine C (CHEBI:82807) has functional parent sucrose (CHEBI:17992) |
| stachyose (CHEBI:17164) has functional parent sucrose (CHEBI:17992) |
| sucrose 6F-phosphate (CHEBI:16308) has functional parent sucrose (CHEBI:17992) |
| sucrose 6G-phosphate (CHEBI:131603) has functional parent sucrose (CHEBI:17992) |
| β-D-fructofuranosyl 6-O-octanoyl-α-D-glucopyranoside (CHEBI:39724) has functional parent sucrose (CHEBI:17992) |
| molasses (CHEBI:83163) has part sucrose (CHEBI:17992) |
| IUPAC Name |
|---|
| β-D-fructofuranosyl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside | KEGG COMPOUND |
| Cane sugar | KEGG COMPOUND |
| sacarosa | ChEBI |
| Saccharose | KEGG COMPOUND |
| Sacharose | ChEBI |
| Sucrose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| sucrose | UniProt |
| Citations |
|---|