EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23O14P |
| Net Charge | 0 |
| Average Mass | 422.276 |
| Monoisotopic Mass | 422.08254 |
| SMILES | O=P(O)(O)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-4-7(16)10(19)12(3-14,25-4)26-11-9(18)8(17)6(15)5(24-11)2-23-27(20,21)22/h4-11,13-19H,1-3H2,(H2,20,21,22)/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | WQQSIXKPRAUZJL-UGDNZRGBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (26826371) | |
| Methylomicrobium alcaliphilum 20Z (ncbitaxon:1091494) | - | PubMed (25577257) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sucrose 6G-phosphate (CHEBI:131603) has functional parent sucrose (CHEBI:17992) |
| sucrose 6G-phosphate (CHEBI:131603) has role Escherichia coli metabolite (CHEBI:76971) |
| sucrose 6G-phosphate (CHEBI:131603) is a disaccharide phosphate (CHEBI:23843) |
| sucrose 6G-phosphate (CHEBI:131603) is conjugate acid of sucrose 6G-phosphate(2−) (CHEBI:91002) |
| Incoming Relation(s) |
| sucrose 6G-phosphate(2−) (CHEBI:91002) is conjugate base of sucrose 6G-phosphate (CHEBI:131603) |
| Synonyms | Source |
|---|---|
| 6-O-Phosphonosucrose | KEGG COMPOUND |
| 6-Phosphosucrose | KEGG COMPOUND |
| beta-D-Fructofuranosyl-6-O-phosphono-alpha-D-glucopyranoside | KEGG COMPOUND |
| Sucrose 6-phosphate | KEGG COMPOUND |
| Sucrose-6-phosphate | ChemIDplus |
| α-D-glucopyranosyl-(1↔2)-β-D-fructofuranoside 6-phosphate | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8136715 | Reaxys |
| CAS:22372-29-8 | KNApSAcK |
| CAS:22372-29-8 | ChemIDplus |
| Citations |
|---|