EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33O19P |
| Net Charge | 0 |
| Average Mass | 584.417 |
| Monoisotopic Mass | 584.13537 |
| SMILES | O=P(O)(O[C@H]1[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)O[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H33O19P/c19-1-5-8(23)11(26)13(16(29)32-5)36-38(30,31)37-14-12(27)9(24)6(2-20)33-17(14)35-18(4-22)15(28)10(25)7(3-21)34-18/h5-17,19-29H,1-4H2,(H,30,31)/t5-,6-,7-,8-,9-,10-,11+,12+,13-,14-,15+,16?,17-,18+/m1/s1 |
| InChIKey | SLYGSIQCXXPYCD-JGWQWBLKSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agrocinopine C (CHEBI:82807) has functional parent D-glucopyranose (CHEBI:4167) |
| agrocinopine C (CHEBI:82807) has functional parent sucrose (CHEBI:17992) |
| agrocinopine C (CHEBI:82807) has role plant metabolite (CHEBI:76924) |
| agrocinopine C (CHEBI:82807) is a agrocinopine (CHEBI:82802) |
| Citations |
|---|