EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31O18P |
| Net Charge | 0 |
| Average Mass | 554.391 |
| Monoisotopic Mass | 554.12480 |
| SMILES | O=P(O)(O[C@@H]1[C@@H](CO)O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O)O[C@H]1C(O)OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H31O18P/c18-1-6-9(23)10(24)11(25)16(31-6)33-17(4-20)14(26)12(7(2-19)32-17)34-36(28,29)35-13-8(22)5(21)3-30-15(13)27/h5-16,18-27H,1-4H2,(H,28,29)/t5-,6+,7+,8-,9+,10-,11+,12+,13+,14-,15?,16+,17-/m0/s1 |
| InChIKey | BUKOQCAFSQWRGX-DPGNQJJNSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agrocinopine A (CHEBI:82804) has functional parent L-arabinopyranose (CHEBI:17535) |
| agrocinopine A (CHEBI:82804) has functional parent sucrose (CHEBI:17992) |
| agrocinopine A (CHEBI:82804) has role plant metabolite (CHEBI:76924) |
| agrocinopine A (CHEBI:82804) is a agrocinopine (CHEBI:82802) |
| Citations |
|---|