EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O4 |
| Net Charge | 0 |
| Average Mass | 392.580 |
| Monoisotopic Mass | 392.29266 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 |
| InChIKey | RUDATBOHQWOJDD-UZVSRGJWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (14989050) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (24816727) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ursodeoxycholic acid (CHEBI:9907) has role human metabolite (CHEBI:77746) |
| ursodeoxycholic acid (CHEBI:9907) has role mouse metabolite (CHEBI:75771) |
| ursodeoxycholic acid (CHEBI:9907) is a bile acid (CHEBI:3098) |
| ursodeoxycholic acid (CHEBI:9907) is a C24-steroid (CHEBI:131620) |
| ursodeoxycholic acid (CHEBI:9907) is a dihydroxy-5β-cholanic acid (CHEBI:23775) |
| ursodeoxycholic acid (CHEBI:9907) is conjugate acid of ursodeoxycholate (CHEBI:78604) |
| Incoming Relation(s) |
| 3α,7β-dihydroxy-12-oxo-5β-cholanic acid (CHEBI:138401) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| glycoursodeoxycholic acid (CHEBI:89929) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| tauroursodeoxycholic acid (CHEBI:80774) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| ursodeoxycholoyl-CoA (CHEBI:138379) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| ursodeoxycholate (CHEBI:78604) is conjugate base of ursodeoxycholic acid (CHEBI:9907) |
| IUPAC Name |
|---|
| 3α,7β-dihydroxy-5β-cholan-24-oic acid |
| Synonyms | Source |
|---|---|
| 3alpha,7beta-Dihydroxy-5beta-cholan-24-oic acid | KEGG COMPOUND |
| (3α,5β,7β)-3,7-dihydroxycholan-24-oic acid | ChemIDplus |
| Actigall | ChemIDplus |
| Ursodeoxycholate | KEGG COMPOUND |
| Ursodeoxycholic acid | KEGG COMPOUND |
| Ursodiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2797 | DrugCentral |
| C07880 | KEGG COMPOUND |
| D00734 | KEGG DRUG |
| DB01586 | DrugBank |
| HMDB0000946 | HMDB |
| LMST04010033 | LIPID MAPS |
| LSM-6555 | LINCS |
| Ursodiol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3219888 | Reaxys |
| CAS:128-13-2 | KEGG COMPOUND |
| CAS:128-13-2 | ChemIDplus |
| Citations |
|---|