EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H45NO6S |
| Net Charge | 0 |
| Average Mass | 499.714 |
| Monoisotopic Mass | 499.29676 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)NCCS(=O)(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17+,18-,19-,20+,21+,22+,24+,25+,26-/m1/s1 |
| InChIKey | BHTRKEVKTKCXOH-LBSADWJPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (22664055) | ||
| blood (UBERON:0000178) | PubMed (14643509) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tauroursodeoxycholic acid (CHEBI:80774) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| tauroursodeoxycholic acid (CHEBI:80774) has role anti-inflammatory agent (CHEBI:67079) |
| tauroursodeoxycholic acid (CHEBI:80774) has role apoptosis inhibitor (CHEBI:68494) |
| tauroursodeoxycholic acid (CHEBI:80774) has role bone density conservation agent (CHEBI:50646) |
| tauroursodeoxycholic acid (CHEBI:80774) has role cardioprotective agent (CHEBI:77307) |
| tauroursodeoxycholic acid (CHEBI:80774) has role human metabolite (CHEBI:77746) |
| tauroursodeoxycholic acid (CHEBI:80774) has role neuroprotective agent (CHEBI:63726) |
| tauroursodeoxycholic acid (CHEBI:80774) is a bile acid taurine conjugate (CHEBI:23219) |
| tauroursodeoxycholic acid (CHEBI:80774) is conjugate acid of tauroursodeoxycholate (CHEBI:132028) |
| Incoming Relation(s) |
| tauroursodeoxycholate (CHEBI:132028) is conjugate base of tauroursodeoxycholic acid (CHEBI:80774) |
| IUPAC Name |
|---|
| 2-[(3α,7β-dihydroxy-24-oxo-5β-cholan-24-yl)amino]ethanesulfonic acid |
| Synonyms | Source |
|---|---|
| 2-(((3-alpha,5-beta,7-beta)-3,7-Dihydroxy-24-oxocholan-24-yl) amino)ethanesulfonic acid | HMDB |
| 2-{[(3α,5β,7β)-3,7-dihydroxy-24-oxocholan-24-yl]amino}ethane-1-sulfonic acid | IUPAC |
| 3α,7β-dihydroxy-5β-cholanoyltaurine | HMDB |
| N-(3α,7β-dihydroxy-5β-cholan-24-oyl)taurine | ChEBI |
| N-ursodeoxycholoyltaurine | ChEBI |
| N-(3-alpha,7-beta-Dihydroxy-5-beta-cholan-24-oyl)-Taurine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 5D5 | PDBeChem |
| C16868 | KEGG COMPOUND |
| CPD-18799 | MetaCyc |
| HMDB0000874 | HMDB |
| LMST05040015 | LIPID MAPS |
| Tauroursodeoxycholic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3228312 | Reaxys |
| CAS:14605-22-2 | ChemIDplus |
| CAS:14605-22-2 | KEGG COMPOUND |
| Citations |
|---|