EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H45NO6S |
| Net Charge | 0 |
| Average Mass | 499.714 |
| Monoisotopic Mass | 499.29676 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)NCCS(=O)(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17+,18-,19-,20+,21+,22+,24+,25+,26-/m1/s1 |
| InChIKey | BHTRKEVKTKCXOH-LBSADWJPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (22664055) | ||
| blood (UBERON:0000178) | PubMed (14643509) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tauroursodeoxycholic acid (CHEBI:80774) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| tauroursodeoxycholic acid (CHEBI:80774) has role anti-inflammatory agent (CHEBI:67079) |
| tauroursodeoxycholic acid (CHEBI:80774) has role apoptosis inhibitor (CHEBI:68494) |
| tauroursodeoxycholic acid (CHEBI:80774) has role bone density conservation agent (CHEBI:50646) |
| tauroursodeoxycholic acid (CHEBI:80774) has role cardioprotective agent (CHEBI:77307) |
| tauroursodeoxycholic acid (CHEBI:80774) has role human metabolite (CHEBI:77746) |
| tauroursodeoxycholic acid (CHEBI:80774) has role neuroprotective agent (CHEBI:63726) |
| tauroursodeoxycholic acid (CHEBI:80774) is a bile acid taurine conjugate (CHEBI:23219) |
| tauroursodeoxycholic acid (CHEBI:80774) is conjugate acid of tauroursodeoxycholate (CHEBI:132028) |
| Incoming Relation(s) |
| tauroursodeoxycholate (CHEBI:132028) is conjugate base of tauroursodeoxycholic acid (CHEBI:80774) |
| IUPAC Name |
|---|
| 2-[(3α,7β-dihydroxy-24-oxo-5β-cholan-24-yl)amino]ethanesulfonic acid |
| Synonyms | Source |
|---|---|
| N-(3-alpha,7-beta-Dihydroxy-5-beta-cholan-24-oyl)-Taurine | HMDB |
| Ursodeoxycholyltaurine | HMDB |
| N-(3α,7β-dihydroxy-5β-cholan-24-oyl)taurine | ChEBI |
| 2-(((3-alpha,5-beta,7-beta)-3,7-Dihydroxy-24-oxocholan-24-yl) amino)ethanesulfonic acid | HMDB |
| TUDCA | HMDB |
| N-ursodeoxycholoyltaurine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16868 | KEGG COMPOUND |
| HMDB0000874 | HMDB |
| LMST05040015 | LIPID MAPS |
| 5D5 | PDBeChem |
| CPD-18799 | MetaCyc |
| Tauroursodeoxycholic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3228312 | Reaxys |
| CAS:14605-22-2 | KEGG COMPOUND |
| CAS:14605-22-2 | ChemIDplus |
| Citations |
|---|