EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO5 |
| Net Charge | 0 |
| Average Mass | 449.632 |
| Monoisotopic Mass | 449.31412 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)NCC(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C26H43NO5/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29/h15-21,24,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16+,17-,18-,19+,20+,21+,24+,25+,26-/m1/s1 |
| InChIKey | GHCZAUBVMUEKKP-XROMFQGDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (22624806) | ||
| faeces (UBERON:0001988) | PubMed (22664055) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycoursodeoxycholic acid (CHEBI:89929) has functional parent ursodeoxycholic acid (CHEBI:9907) |
| glycoursodeoxycholic acid (CHEBI:89929) has role human blood serum metabolite (CHEBI:85234) |
| glycoursodeoxycholic acid (CHEBI:89929) has role neuroprotective agent (CHEBI:63726) |
| glycoursodeoxycholic acid (CHEBI:89929) is a N-acylglycine (CHEBI:16180) |
| glycoursodeoxycholic acid (CHEBI:89929) is a bile acid glycine conjugate (CHEBI:36255) |
| glycoursodeoxycholic acid (CHEBI:89929) is conjugate acid of glycoursodeoxycholate (CHEBI:132030) |
| Incoming Relation(s) |
| glycoursodeoxycholate (CHEBI:132030) is conjugate base of glycoursodeoxycholic acid (CHEBI:89929) |
| IUPAC Name |
|---|
| N-(3α,7β-dihydroxy-5β-cholan-24-oyl)glycine |
| Synonyms | Source |
|---|---|
| 3α,7β-dihydroxy-5β-cholanoylglycine | HMDB |
| N-[(3α,5β,7β)-3,7-dihydroxy-24-oxocholan-24-yl]glycine | HMDB |
| N-(3α,7β-dihydroxy-5β-cholan-24-oyl)glycine | HMDB |
| Glycine ursodeoxycholic acid | ChemIDplus |
| Glycylursodeoxycholic acid | HMDB |
| GUDCA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000708 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3226178 | Reaxys |
| CAS:64480-66-6 | ChemIDplus |
| Citations |
|---|