EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO6 |
| Net Charge | 0 |
| Average Mass | 195.171 |
| Monoisotopic Mass | 195.07429 |
| SMILES | N[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A2122h_2*N]/1/ |
| InChI | InChI=1S/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1 |
| InChIKey | UFYKDFXCZBTLOO-TXICZTDVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) has functional parent D-gluconic acid (CHEBI:33198) |
| 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) has role bacterial metabolite (CHEBI:76969) |
| 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) is a gluconic acid derivative (CHEBI:33772) |
| 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) is conjugate acid of 2-amino-2-deoxy-D-gluconate (CHEBI:33805) |
| 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) is tautomer of 2-amino-2-deoxy-D-gluconic acid zwitterion (CHEBI:58269) |
| Incoming Relation(s) |
| N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) has functional parent 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) |
| D-glucosaminic acid 6-phosphate (CHEBI:75865) has functional parent 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) |
| 2-amino-2-deoxy-D-gluconate (CHEBI:33805) is conjugate base of 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) |
| 2-amino-2-deoxy-D-gluconic acid zwitterion (CHEBI:58269) is tautomer of 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-D-gluconic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-2-deoxy-D-gluconate | KEGG COMPOUND |
| (3R,4S,5R)-3,4,5,6-tetrahydroxy-D-norleucine | IUPAC |
| D-glucosaminate | ChEBI |
| D-Glucosaminate | KEGG COMPOUND |
| D-Glucosaminic acid | KEGG COMPOUND |
| Glucosaminate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03752 | KEGG COMPOUND |
| C03752 | KEGG COMPOUND |
| GLUCOSAMINATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726033 | Reaxys |
| CAS:3646-68-2 | ChemIDplus |
| CAS:3646-68-2 | KEGG COMPOUND |
| Citations |
|---|