EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO6 |
| Net Charge | 0 |
| Average Mass | 219.193 |
| Monoisotopic Mass | 219.07429 |
| SMILES | CC(=O)N[C@H]1C(=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-7,10,12-13H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | NELQYZRSPDCGRQ-DBRKOABJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Callinectes sapidus (ncbitaxon:6763) | urine (BTO:0001419) | PubMed (28686351) | |
| Telmessus cheiragonus (ncbitaxon:324081) | urine (BTO:0001419) | PubMed (27132136) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.52 (beta-N-acetylhexosaminidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of β-N-acetylhexosaminidase (EC 3.2.1.52). pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) has functional parent 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) |
| N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) has role animal metabolite (CHEBI:75767) |
| N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) has role EC 3.2.1.52 (β-N-acetylhexosaminidase) inhibitor (CHEBI:184301) |
| N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) has role pheromone (CHEBI:26013) |
| N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) is a deoxygluconolactone (CHEBI:57246) |
| Incoming Relation(s) |
| N,N'-diacetylchitobiono-1,5-lactone (CHEBI:143145) has functional parent N-acetyl-D-glucosamino-1,5-lactone (CHEBI:42870) |
| IUPAC Name |
|---|
| N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-oxotetrahydro-2H-pyran-3-yl]acetamide |
| Synonyms | Source |
|---|---|
| 2-acetamido-2-deoxy-D-glucono-1,5-lactone | DrugBank |
| CD 80110 | ChemIDplus |
| CD-80110 | ChemIDplus |
| N-acetylglucosamino-1,5-lactone | ChEBI |
| 2-acetamido-2-deoxy-D-glucono-δ-lactone | ChEBI |
| 2-(acetylamino)-2-deoxy-D-gluconic acid δ-lactone | ChEBI |
| UniProt Name | Source |
|---|---|
| N-acetyl-D-glucosamino-1,5-lactone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1685090 | Reaxys |
| CAS:19026-22-3 | ChemIDplus |
| Citations |
|---|