EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO9P |
| Net Charge | 0 |
| Average Mass | 275.150 |
| Monoisotopic Mass | 275.04062 |
| SMILES | N[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| WURCS | WURCS=2.0/1,1,0/[A2122h_2*N_6*OPO/3O/3=O]/1/ |
| InChI | InChI=1S/C6H14NO9P/c7-3(6(11)12)5(10)4(9)2(8)1-16-17(13,14)15/h2-5,8-10H,1,7H2,(H,11,12)(H2,13,14,15)/t2-,3-,4-,5-/m1/s1 |
| InChIKey | JZTCDGMXXSOZRP-TXICZTDVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucosaminic acid 6-phosphate (CHEBI:75865) has functional parent 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) |
| D-glucosaminic acid 6-phosphate (CHEBI:75865) is a carbohydrate phosphate (CHEBI:26816) |
| D-glucosaminic acid 6-phosphate (CHEBI:75865) is a gluconic acid derivative (CHEBI:33772) |
| D-glucosaminic acid 6-phosphate (CHEBI:75865) is conjugate acid of D-glucosaminic acid 6-phosphate(2−) (CHEBI:75705) |
| Incoming Relation(s) |
| D-glucosaminic acid 6-phosphate(2−) (CHEBI:75705) is conjugate base of D-glucosaminic acid 6-phosphate (CHEBI:75865) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-6-O-phosphono-D-gluconic acid |
| Synonyms | Source |
|---|---|
| (3R,4S,5R)-3,4,5-trihydroxy-6-(phosphonooxy)-D-norleucine | IUPAC |
| 6-phospho-2-amino-2-deoxy-D-gluconic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-15586 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2508530 | Reaxys |