EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9738 - trimipramine
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | CC(CN(C)C)CN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H26N2/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | ZSCDBOWYZJWBIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimipramine (CHEBI:9738) has functional parent imipramine (CHEBI:47499) |
| trimipramine (CHEBI:9738) has role antidepressant (CHEBI:35469) |
| trimipramine (CHEBI:9738) has role environmental contaminant (CHEBI:78298) |
| trimipramine (CHEBI:9738) has role xenobiotic (CHEBI:35703) |
| trimipramine (CHEBI:9738) is a dibenzoazepine (CHEBI:47804) |
| trimipramine (CHEBI:9738) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| trimipramine maleate (CHEBI:35030) has part trimipramine (CHEBI:9738) |
| IUPAC Name |
|---|
| 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N,2-trimethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 10,11-dihydro-N,N,β-trimethyl-5H-dibenz[b,f]azepine-5-propanamine | NIST Chemistry WebBook |
| 5-[3-(dimethylamino)-2-methylpropyl]-10,11-dihydro-5H-dibenz[b,f]azepine | NIST Chemistry WebBook |
| 5-(γ-dimethylamino-β-methylpropyl)-10,11-dihydro-5H-dibenzo[b,f]azepine | NIST Chemistry WebBook |
| RP-7162 | NIST Chemistry WebBook |
| Trimipramine | ChemIDplus |
| Trimeprimine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00394 | KEGG DRUG |
| Trimipramine | Wikipedia |
| DB00726 | DrugBank |
| HMDB0014864 | HMDB |
| CN103893187 | Patent |
| LSM-1371 | LINCS |
| 2758 | DrugCentral |
| Citations |
|---|