EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | CC(CN(C)C)CN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H26N2/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | ZSCDBOWYZJWBIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimipramine (CHEBI:9738) has functional parent imipramine (CHEBI:47499) |
| trimipramine (CHEBI:9738) has role antidepressant (CHEBI:35469) |
| trimipramine (CHEBI:9738) has role antipsychotic agent (CHEBI:35476) |
| trimipramine (CHEBI:9738) has role anxiolytic drug (CHEBI:35474) |
| trimipramine (CHEBI:9738) has role environmental contaminant (CHEBI:78298) |
| trimipramine (CHEBI:9738) has role xenobiotic (CHEBI:35703) |
| trimipramine (CHEBI:9738) is a dibenzoazepine (CHEBI:47804) |
| trimipramine (CHEBI:9738) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| trimipramine maleate (CHEBI:35030) has part trimipramine (CHEBI:9738) |
| IUPAC Name |
|---|
| 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N,2-trimethylpropan-1-amine |
| INN | Source |
|---|---|
| trimipramina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10,11-dihydro-N,N,β-trimethyl-5H-dibenz[b,f]azepine-5-propanamine | NIST Chemistry WebBook |
| 5-[3-(dimethylamino)-2-methylpropyl]-10,11-dihydro-5H-dibenz[b,f]azepine | NIST Chemistry WebBook |
| 5-(γ-dimethylamino-β-methylpropyl)-10,11-dihydro-5H-dibenzo[b,f]azepine | NIST Chemistry WebBook |
| 7162 RP | ChEMBL |
| 7162-RP | ChEMBL |
| IL 6001 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2758 | DrugCentral |
| CN103893187 | Patent |
| D00394 | KEGG DRUG |
| DB00726 | DrugBank |
| HMDB0014864 | HMDB |
| LSM-1371 | LINCS |
| Trimipramine | Wikipedia |
| Citations |
|---|