EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3S2 |
| Net Charge | 0 |
| Average Mass | 399.629 |
| Monoisotopic Mass | 399.18029 |
| SMILES | CCSc1ccc2c(c1)N(CCCN1CCN(C)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H29N3S2/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24/h4-5,7-10,17H,3,6,11-16H2,1-2H3 |
| InChIKey | XCTYLCDETUVOIP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiethylperazine (CHEBI:9544) has functional parent perazine (CHEBI:59118) |
| thiethylperazine (CHEBI:9544) has role antiemetic (CHEBI:50919) |
| thiethylperazine (CHEBI:9544) has role dopaminergic antagonist (CHEBI:48561) |
| thiethylperazine (CHEBI:9544) has role histamine antagonist (CHEBI:37956) |
| thiethylperazine (CHEBI:9544) has role muscarinic antagonist (CHEBI:48876) |
| thiethylperazine (CHEBI:9544) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| thiethylperazine (CHEBI:9544) has role serotonergic antagonist (CHEBI:48279) |
| thiethylperazine (CHEBI:9544) is a N-methylpiperazine (CHEBI:46920) |
| thiethylperazine (CHEBI:9544) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| thiethylperazine maleate (CHEBI:32216) has part thiethylperazine (CHEBI:9544) |
| IUPAC Name |
|---|
| 2-(ethylsulfanyl)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine |
| INNs | Source |
|---|---|
| thiethylperazine | ChEBI |
| thiéthylpérazine | ChEBI |
| thiethylperazinum | ChEBI |
| tietilperazina | ChEBI |
| Synonyms | Source |
|---|---|
| 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine | ChEBI |
| 3-Ethylmercapto-10-(1'-methylpiperazinyl-4'-propyl)phenothiazine | ChemIDplus |
| Ethylthioperazine | KEGG COMPOUND |
| Thiethylperazine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2630 | DrugCentral |
| C07132 | KEGG COMPOUND |
| D02354 | KEGG DRUG |
| DB00372 | DrugBank |
| HMDB0014516 | HMDB |
| LSM-3556 | LINCS |
| Thiethylperazine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:52127 | Reaxys |
| CAS:1420-55-9 | ChemIDplus |
| Citations |
|---|