EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 4H.C22H29N3S2.2C4H2O4 |
| Net Charge | 0 |
| Average Mass | 631.773 |
| Monoisotopic Mass | 631.20221 |
| SMILES | CCSc1ccc2c(c1)N(CCCN1CCN(C)CC1)c1ccccc1S2.O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-].[H+].[H+].[H+].[H+] |
| InChI | InChI=1S/C22H29N3S2.2C4H4O4/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24;2*5-3(6)1-2-4(7)8/h4-5,7-10,17H,3,6,11-16H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | RVBRTNPNFYFDMZ-SPIKMXEPSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiethylperazine maleate (CHEBI:32216) has part thiethylperazine (CHEBI:9544) |
| thiethylperazine maleate (CHEBI:32216) has role anticoronaviral agent (CHEBI:149553) |
| thiethylperazine maleate (CHEBI:32216) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 2-(ethylsulfanyl)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine di[(2Z)-but-2-enedioate] |
| Synonyms | Source |
|---|---|
| 10H-Phenothiazine, 2-(ethylthio)-10-(3-(4-methyl-1-piperazinyl)propyl)-, (Z)-2-butenedioate (1:2) | ChemIDplus |
| 2-Ethylmercapto-10-(3-(1-methyl-4-piperazinyl)propyl)phenothiazine dimaleate | ChemIDplus |
| 2-(Ethylthio)-10-(3-(4-methyl-1-piperazinyl)propyl)phenothiazine dimaleate | ChemIDplus |
| Thiethylperazine dimaleate | ChemIDplus |
| Tietylperazine maleate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Norzine | DrugBank |
| Torecan | DrugBank |