EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3S |
| Net Charge | 0 |
| Average Mass | 339.508 |
| Monoisotopic Mass | 339.17692 |
| SMILES | CN1CCN(CCCN2c3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C20H25N3S/c1-21-13-15-22(16-14-21)11-6-12-23-17-7-2-4-9-19(17)24-20-10-5-3-8-18(20)23/h2-5,7-10H,6,11-16H2,1H3 |
| InChIKey | WEYVCQFUGFRXOM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perazine (CHEBI:59118) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| perazine (CHEBI:59118) has role dopaminergic antagonist (CHEBI:48561) |
| perazine (CHEBI:59118) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| perazine (CHEBI:59118) is a N-alkylpiperazine (CHEBI:46845) |
| perazine (CHEBI:59118) is a N-methylpiperazine (CHEBI:46920) |
| perazine (CHEBI:59118) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| thiethylperazine (CHEBI:9544) has functional parent perazine (CHEBI:59118) |
| IUPAC Name |
|---|
| 10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine |
| Synonyms | Source |
|---|---|
| 10-(3-(4-Methyl-1-piperazinyl)propyl)-10H-phenothiazine | NIST Chemistry WebBook |
| N-(3-(4-Methyl-1-piperazinyl)propyl)phenothiazine | ChemIDplus |
| N-Methyl-piperazinyl-N'-propyl-phenothiazin | ChemIDplus |
| N-Methyl-piperazinylpropyl-phenothiazine | NIST Chemistry WebBook |
| Pernazine | ChemIDplus |
| Citations |
|---|