EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1c(O)cc2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| InChIKey | OBBCRPUNCUPUOS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bassia scoparia (ncbitaxon:83154) | - | PubMed (24380276) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tectorigenin (CHEBI:9429) has functional parent isoflavone (CHEBI:18220) |
| tectorigenin (CHEBI:9429) has role anti-inflammatory agent (CHEBI:67079) |
| tectorigenin (CHEBI:9429) has role plant metabolite (CHEBI:76924) |
| tectorigenin (CHEBI:9429) is a 7-hydroxyisoflavones (CHEBI:55465) |
| tectorigenin (CHEBI:9429) is a methoxyisoflavone (CHEBI:38756) |
| Incoming Relation(s) |
| 7-O-methyltectorigenin (CHEBI:70033) has functional parent tectorigenin (CHEBI:9429) |
| tectoridin (CHEBI:9428) has functional parent tectorigenin (CHEBI:9429) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5,7,4'-trihydroxy-6-methoxyisoflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10534 | KEGG COMPOUND |
| C00002577 | KNApSAcK |
| LMPK12050385 | LIPID MAPS |
| HMDB0042024 | HMDB |
| Tectorigenin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:305601 | Reaxys |
| CAS:548-77-6 | KEGG COMPOUND |
| CAS:548-77-6 | ChemIDplus |
| Citations |
|---|