EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O11 |
| Net Charge | 0 |
| Average Mass | 462.407 |
| Monoisotopic Mass | 462.11621 |
| SMILES | COc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C22H22O11/c1-30-21-13(32-22-20(29)19(28)17(26)14(7-23)33-22)6-12-15(18(21)27)16(25)11(8-31-12)9-2-4-10(24)5-3-9/h2-6,8,14,17,19-20,22-24,26-29H,7H2,1H3/t14-,17-,19+,20-,22-/m1/s1 |
| InChIKey | CNOURESJATUGPN-UDEBZQQRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maackia amurensis (ncbitaxon:37501) | - | PubMed (24252334) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tectoridin (CHEBI:9428) has functional parent tectorigenin (CHEBI:9429) |
| tectoridin (CHEBI:9428) has role plant metabolite (CHEBI:76924) |
| tectoridin (CHEBI:9428) is a 7-hydroxyisoflavones 7-O-β-D-glucoside (CHEBI:140301) |
| tectoridin (CHEBI:9428) is a hydroxyisoflavone (CHEBI:38755) |
| tectoridin (CHEBI:9428) is a methoxyisoflavone (CHEBI:38756) |
| tectoridin (CHEBI:9428) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Shekanin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002576 | KNApSAcK |
| C10533 | KEGG COMPOUND |
| LMPK12050372 | LIPID MAPS |
| Tectoridin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6991307 | Reaxys |
| CAS:611-40-5 | KEGG COMPOUND |
| CAS:611-40-5 | ChemIDplus |
| Citations |
|---|