EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1cc2occ(-c3ccc(O)cc3)c(=O)c2c(O)c1OC |
| InChI | InChI=1S/C17H14O6/c1-21-13-7-12-14(16(20)17(13)22-2)15(19)11(8-23-12)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3 |
| InChIKey | JDKYUORVNMYEIK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-methyltectorigenin (CHEBI:70033) has functional parent tectorigenin (CHEBI:9429) |
| 7-O-methyltectorigenin (CHEBI:70033) has role plant metabolite (CHEBI:76924) |
| 7-O-methyltectorigenin (CHEBI:70033) is a 7-methoxyisoflavones (CHEBI:140356) |
| 7-O-methyltectorigenin (CHEBI:70033) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-6,7-dimethoxychromen-4-one | ChEBI |
| 4',5-dihydroxy-6,7-dimethoxyisoflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12050388 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1296649 | Reaxys |
| CAS:1096-58-8 | ChemIDplus |
| Citations |
|---|