EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N2O3S |
| Net Charge | 0 |
| Average Mass | 222.310 |
| Monoisotopic Mass | 222.10381 |
| SMILES | CCCCS(=N)(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12)/t7-,14?/m0/s1 |
| InChIKey | KJQFBVYMGADDTQ-CVSPRKDYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor An acid—amino-acid ligase inhibitor that inhibits the action of a glutamate—cysteine ligase (EC 6.3.2.2) ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-buthionine-(S,R)-sulfoximine (CHEBI:94288) has role EC 6.3.2.2 (glutamate—cysteine ligase) inhibitor (CHEBI:75599) |
| L-buthionine-(S,R)-sulfoximine (CHEBI:94288) has role ferroptosis inducer (CHEBI:173085) |
| L-buthionine-(S,R)-sulfoximine (CHEBI:94288) is a 2-amino-4-(S-butylsulfonimidoyl)butanoic acid (CHEBI:176510) |
| Incoming Relation(s) |
| S-butyl-DL-homocysteine (S,R)-sulfoximine (CHEBI:28714) has part L-buthionine-(S,R)-sulfoximine (CHEBI:94288) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(S-butylsulfonimidoyl)butanoic acid |
| Synonyms | Source |
|---|---|
| L-buthionine sulfoximine | ChemIDplus |
| L-buthionine (SR)-sulfoximine | ChemIDplus |
| L-buthionine-(S,R)-sulfoximine | ChemIDplus |
| L-buthionine-(S,R)-sulphoximine | ChemIDplus |
| (2S)-2-amino-4-(S-butylsulfonimidoyl)butyric acid | ChEBI |
| L-BSO | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2367136 | Reaxys |
| CAS:83730-53-4 | ChemIDplus |
| Citations |
|---|