EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28714 - S-butyl-DL-homocysteine (S,R)-sulfoximine
| Formula | C8H18N2O3S |
| Net Charge | 0 |
| Average Mass | 222.310 |
| Monoisotopic Mass | 222.10381 |
| SMILES | CCCCS(=N)(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
| InChIKey | KJQFBVYMGADDTQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 6.3.2.2 (glutamate--cysteine ligase) inhibitor An acid—amino-acid ligase inhibitor that inhibits the action of a glutamate—cysteine ligase (EC 6.3.2.2) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-butyl-DL-homocysteine (S,R)-sulfoximine (CHEBI:28714) has part D-buthionine-(S,R)-sulfoximine (CHEBI:176509) |
| S-butyl-DL-homocysteine (S,R)-sulfoximine (CHEBI:28714) has part L-buthionine-(S,R)-sulfoximine (CHEBI:94288) |
| S-butyl-DL-homocysteine (S,R)-sulfoximine (CHEBI:28714) has role EC 6.3.2.2 (glutamate—cysteine ligase) inhibitor (CHEBI:75599) |
| S-butyl-DL-homocysteine (S,R)-sulfoximine (CHEBI:28714) has role ferroptosis inducer (CHEBI:173085) |
| S-butyl-DL-homocysteine (S,R)-sulfoximine (CHEBI:28714) is a diastereoisomeric mixture (CHEBI:60915) |
| IUPAC Name |
|---|
| (2RS)-2-amino-4-(S-butylsulfonimidoyl)butanoic acid |
| Synonyms | Source |
|---|---|
| S-butyl-DL-homocysteine-[S,R]-sulfoximine | KEGG COMPOUND |
| Buthionine sulfoximine | KEGG COMPOUND |
| buthionine sulphoximine | ChemIDplus |
| DL-butathionine-(S,R)-sulfoximine | ChEBI |
| buthionine sulfoximine | ChemIDplus |
| (2RS)-2-amino-4-(S-butylsulfonimidoyl)butanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04543 | KEGG COMPOUND |
| LSM-36606 | LINCS |
| Buthionine_sulfoximine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:236716 | Beilstein |
| CAS:5072-26-4 | KEGG COMPOUND |
| CAS:5072-26-4 | ChemIDplus |
| Citations |
|---|